C13H13N5O2 — CID 80911841
[6-(2,3-dihydroindol-1-yl)-5-nitro-2-pyridinyl]hydrazine (PubChem CID 80911841) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is [6-(2,3-dihydroindol-1-yl)-5-nitro-2-pyridinyl]hydrazine.
| Compound Name | [6-(2,3-dihydroindol-1-yl)-5-nitro-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 80911841 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | [6-(2,3-dihydroindol-1-yl)-5-nitro-2-pyridinyl]hydrazine |
| SMILES | NNc1ccc([N+](=O)[O-])c(N2CCc3ccccc32)n1 |
| InChI | InChI=1S/C13H13N5O2/c14-16-12-6-5-11(18(19)20)13(15-12)17-8-7-9-3-1-2-4-10(9)17/h1-6H,7-8,14H2,(H,15,16) |
| InChIKey | METBFZZJABZFSB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|