C14H13N3O2 — CID 82299179
4-(2,3-dihydroindol-1-yl)-3-nitroaniline (PubChem CID 82299179) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 4-(2,3-dihydroindol-1-yl)-3-nitroaniline.
| Compound Name | 4-(2,3-dihydroindol-1-yl)-3-nitroaniline |
|---|---|
| PubChem CID | 82299179 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-(2,3-dihydroindol-1-yl)-3-nitroaniline |
| SMILES | Nc1ccc(N2CCc3ccccc32)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13N3O2/c15-11-5-6-13(14(9-11)17(18)19)16-8-7-10-3-1-2-4-12(10)16/h1-6,9H,7-8,15H2 |
| InChIKey | MOYPBBJCMJLXJW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|