C16H15IN2O2 — CID 106494555
1-(3-iodo-4-nitrophenyl)-2,3,4,5-tetrahydro-1-benzazepine (PubChem CID 106494555) has the molecular formula C16H15IN2O2 and a molecular weight of 394.21 g/mol. Its IUPAC name is 1-(3-iodo-4-nitrophenyl)-2,3,4,5-tetrahydro-1-benzazepine.
| Compound Name | 1-(3-iodo-4-nitrophenyl)-2,3,4,5-tetrahydro-1-benzazepine |
|---|---|
| PubChem CID | 106494555 |
| Molecular Formula | C16H15IN2O2 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 1-(3-iodo-4-nitrophenyl)-2,3,4,5-tetrahydro-1-benzazepine |
| SMILES | O=[N+]([O-])c1ccc(N2CCCCc3ccccc32)cc1I |
| InChI | InChI=1S/C16H15IN2O2/c17-14-11-13(8-9-16(14)19(20)21)18-10-4-3-6-12-5-1-2-7-15(12)18/h1-2,5,7-9,11H,3-4,6,10H2 |
| InChIKey | CPTNURCCRRBHGL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|