C10H11IN2O4 — CID 106670917
1-(3-iodo-4-nitrophenyl)pyrrolidine-3,4-diol (PubChem CID 106670917) has the molecular formula C10H11IN2O4 and a molecular weight of 350.11 g/mol. Its IUPAC name is 1-(3-iodo-4-nitrophenyl)pyrrolidine-3,4-diol.
| Compound Name | 1-(3-iodo-4-nitrophenyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106670917 |
| Molecular Formula | C10H11IN2O4 |
| Molecular Weight | 350.11 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 1-(3-iodo-4-nitrophenyl)pyrrolidine-3,4-diol |
| SMILES | O=[N+]([O-])c1ccc(N2CC(O)C(O)C2)cc1I |
| InChI | InChI=1S/C10H11IN2O4/c11-7-3-6(1-2-8(7)13(16)17)12-4-9(14)10(15)5-12/h1-3,9-10,14-15H,4-5H2 |
| InChIKey | MTFFXAVCIADKNP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.11 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|