C12H13IN4O3 — CID 103739234
7-(3-iodo-4-nitrophenyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 103739234) has the molecular formula C12H13IN4O3 and a molecular weight of 388.17 g/mol. Its IUPAC name is 7-(3-iodo-4-nitrophenyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-(3-iodo-4-nitrophenyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 103739234 |
| Molecular Formula | C12H13IN4O3 |
| Molecular Weight | 388.17 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 7-(3-iodo-4-nitrophenyl)-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | O=C1NCC2CN(c3ccc([N+](=O)[O-])c(I)c3)CCN12 |
| InChI | InChI=1S/C12H13IN4O3/c13-10-5-8(1-2-11(10)17(19)20)15-3-4-16-9(7-15)6-14-12(16)18/h1-2,5,9H,3-4,6-7H2,(H,14,18) |
| InChIKey | BSMOVYOSCIDFOF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.17 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|