C10H8IN3O4 — CID 106494572
4-(3-iodo-4-nitrophenyl)piperazine-2,6-dione (PubChem CID 106494572) has the molecular formula C10H8IN3O4 and a molecular weight of 361.10 g/mol. Its IUPAC name is 4-(3-iodo-4-nitrophenyl)piperazine-2,6-dione.
| Compound Name | 4-(3-iodo-4-nitrophenyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 106494572 |
| Molecular Formula | C10H8IN3O4 |
| Molecular Weight | 361.10 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 4-(3-iodo-4-nitrophenyl)piperazine-2,6-dione |
| SMILES | O=C1CN(c2ccc([N+](=O)[O-])c(I)c2)CC(=O)N1 |
| InChI | InChI=1S/C10H8IN3O4/c11-7-3-6(1-2-8(7)14(17)18)13-4-9(15)12-10(16)5-13/h1-3H,4-5H2,(H,12,15,16) |
| InChIKey | JWAWIKQFKNEGTG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.10 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|