C16H19N3O2S — CID 28795713
5-amino-2-(2,3-dihydroindol-1-yl)-N,N-dimethylbenzenesulfonamide (PubChem CID 28795713) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is 5-amino-2-(2,3-dihydroindol-1-yl)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 5-amino-2-(2,3-dihydroindol-1-yl)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 28795713 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 5-amino-2-(2,3-dihydroindol-1-yl)-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cc(N)ccc1N1CCc2ccccc21 |
| InChI | InChI=1S/C16H19N3O2S/c1-18(2)22(20,21)16-11-13(17)7-8-15(16)19-10-9-12-5-3-4-6-14(12)19/h3-8,11H,9-10,17H2,1-2H3 |
| InChIKey | ARYDUCBORXCOQK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|