C12H19N5O2 — CID 80918944
[6-(4,4-dimethylpiperidin-1-yl)-5-nitro-2-pyridinyl]hydrazine (PubChem CID 80918944) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is [6-(4,4-dimethylpiperidin-1-yl)-5-nitro-2-pyridinyl]hydrazine.
| Compound Name | [6-(4,4-dimethylpiperidin-1-yl)-5-nitro-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 80918944 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | [6-(4,4-dimethylpiperidin-1-yl)-5-nitro-2-pyridinyl]hydrazine |
| SMILES | CC1(C)CCN(c2nc(NN)ccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H19N5O2/c1-12(2)5-7-16(8-6-12)11-9(17(18)19)3-4-10(14-11)15-13/h3-4H,5-8,13H2,1-2H3,(H,14,15) |
| InChIKey | MOIJGTNMQMKBFK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|