C12H18N4O3 — CID 103358849
1-[6-(ethylamino)-3-nitro-2-pyridinyl]-3-methylpyrrolidin-3-ol (PubChem CID 103358849) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 1-[6-(ethylamino)-3-nitro-2-pyridinyl]-3-methylpyrrolidin-3-ol.
| Compound Name | 1-[6-(ethylamino)-3-nitro-2-pyridinyl]-3-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 103358849 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 1-[6-(ethylamino)-3-nitro-2-pyridinyl]-3-methylpyrrolidin-3-ol |
| SMILES | CCNc1ccc([N+](=O)[O-])c(N2CCC(C)(O)C2)n1 |
| InChI | InChI=1S/C12H18N4O3/c1-3-13-10-5-4-9(16(18)19)11(14-10)15-7-6-12(2,17)8-15/h4-5,17H,3,6-8H2,1-2H3,(H,13,14) |
| InChIKey | PHKBPGBTMVFUSD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 91.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|