About 1-(3-ethoxy-2-nitrophenyl)-1,2,4-triazole
1-(3-ethoxy-2-nitrophenyl)-1,2,4-triazole (PubChem CID 113393202) has the molecular formula C10H10N4O3
and a molecular weight of 234.22 g/mol. Its IUPAC name is 1-(3-ethoxy-2-nitrophenyl)-1,2,4-triazole.
Molecular Properties
| Compound Name | 1-(3-ethoxy-2-nitrophenyl)-1,2,4-triazole |
| PubChem CID | 113393202 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 1-(3-ethoxy-2-nitrophenyl)-1,2,4-triazole |
| SMILES | CCOc1cccc(-n2cncn2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N4O3/c1-2-17-9-5-3-4-8(10(9)14(15)16)13-7-11-6-12-13/h3-7H,2H2,1H3 |
| InChIKey | ODTYUXWHGMJNQO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-ethoxy-2-nitrophenyl)-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethoxy-2-nitrophenyl)-1,2,4-triazole?
The IUPAC name of 1-(3-ethoxy-2-nitrophenyl)-1,2,4-triazole (CID 113393202) is 1-(3-ethoxy-2-nitrophenyl)-1,2,4-triazole.
What is the SMILES notation for 1-(3-ethoxy-2-nitrophenyl)-1,2,4-triazole?
The canonical SMILES for 1-(3-ethoxy-2-nitrophenyl)-1,2,4-triazole is CCOc1cccc(-n2cncn2)c1[N+](=O)[O-].
What is the InChIKey of 1-(3-ethoxy-2-nitrophenyl)-1,2,4-triazole?
The InChIKey is ODTYUXWHGMJNQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O3/c1-2-17-9-5-3-4-8(10(9)14(15)16)13-7-11-6-12-13/h3-7H,2H2,1H3.
What are the key properties of 1-(3-ethoxy-2-nitrophenyl)-1,2,4-triazole?
1-(3-ethoxy-2-nitrophenyl)-1,2,4-triazole has a molecular weight of 234.22 g/mol, XLogP of 1.57, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethoxy-2-nitrophenyl)-1,2,4-triazole is sourced from PubChem (CID 113393202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).