About 2-methyl-4-(1,2,4-triazol-1-yl)-7-(trifluoromethyl)quinoline
2-methyl-4-(1,2,4-triazol-1-yl)-7-(trifluoromethyl)quinoline (PubChem CID 14837837) has the molecular formula C13H9F3N4
and a molecular weight of 278.24 g/mol. Its IUPAC name is 2-methyl-4-(1,2,4-triazol-1-yl)-7-(trifluoromethyl)quinoline.
Molecular Properties
| Compound Name | 2-methyl-4-(1,2,4-triazol-1-yl)-7-(trifluoromethyl)quinoline |
| PubChem CID | 14837837 |
| Molecular Formula | C13H9F3N4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-methyl-4-(1,2,4-triazol-1-yl)-7-(trifluoromethyl)quinoline |
| SMILES | Cc1cc(-n2cncn2)c2ccc(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C13H9F3N4/c1-8-4-12(20-7-17-6-18-20)10-3-2-9(13(14,15)16)5-11(10)19-8/h2-7H,1H3 |
| InChIKey | HEYIOTMHCHUOHB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-4-(1,2,4-triazol-1-yl)-7-(trifluoromethyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(1,2,4-triazol-1-yl)-7-(trifluoromethyl)quinoline?
The IUPAC name of 2-methyl-4-(1,2,4-triazol-1-yl)-7-(trifluoromethyl)quinoline (CID 14837837) is 2-methyl-4-(1,2,4-triazol-1-yl)-7-(trifluoromethyl)quinoline.
What is the SMILES notation for 2-methyl-4-(1,2,4-triazol-1-yl)-7-(trifluoromethyl)quinoline?
The canonical SMILES for 2-methyl-4-(1,2,4-triazol-1-yl)-7-(trifluoromethyl)quinoline is Cc1cc(-n2cncn2)c2ccc(C(F)(F)F)cc2n1.
What is the InChIKey of 2-methyl-4-(1,2,4-triazol-1-yl)-7-(trifluoromethyl)quinoline?
The InChIKey is HEYIOTMHCHUOHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F3N4/c1-8-4-12(20-7-17-6-18-20)10-3-2-9(13(14,15)16)5-11(10)19-8/h2-7H,1H3.
What are the key properties of 2-methyl-4-(1,2,4-triazol-1-yl)-7-(trifluoromethyl)quinoline?
2-methyl-4-(1,2,4-triazol-1-yl)-7-(trifluoromethyl)quinoline has a molecular weight of 278.24 g/mol, XLogP of 3.14, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(1,2,4-triazol-1-yl)-7-(trifluoromethyl)quinoline is sourced from PubChem (CID 14837837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).