C12H8Cl2N4 — CID 14837827
6,8-dichloro-2-methyl-4-(1,2,4-triazol-1-yl)quinoline (PubChem CID 14837827) has the molecular formula C12H8Cl2N4 and a molecular weight of 279.13 g/mol. Its IUPAC name is 6,8-dichloro-2-methyl-4-(1,2,4-triazol-1-yl)quinoline.
| Compound Name | 6,8-dichloro-2-methyl-4-(1,2,4-triazol-1-yl)quinoline |
|---|---|
| PubChem CID | 14837827 |
| Molecular Formula | C12H8Cl2N4 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 6,8-dichloro-2-methyl-4-(1,2,4-triazol-1-yl)quinoline |
| SMILES | Cc1cc(-n2cncn2)c2cc(Cl)cc(Cl)c2n1 |
| InChI | InChI=1S/C12H8Cl2N4/c1-7-2-11(18-6-15-5-16-18)9-3-8(13)4-10(14)12(9)17-7/h2-6H,1H3 |
| InChIKey | MOOQWHYQSJMYHN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |