C12H9F3N2O — CID 82574068
2-methyl-7-(trifluoromethyl)quinoline-4-carboxamide (PubChem CID 82574068) has the molecular formula C12H9F3N2O and a molecular weight of 254.21 g/mol. Its IUPAC name is 2-methyl-7-(trifluoromethyl)quinoline-4-carboxamide.
| Compound Name | 2-methyl-7-(trifluoromethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 82574068 |
| Molecular Formula | C12H9F3N2O |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-methyl-7-(trifluoromethyl)quinoline-4-carboxamide |
| SMILES | Cc1cc(C(N)=O)c2ccc(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C12H9F3N2O/c1-6-4-9(11(16)18)8-3-2-7(12(13,14)15)5-10(8)17-6/h2-5H,1H3,(H2,16,18) |
| InChIKey | OGYZWLVLVVDXRG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |