C13H14N2O — CID 82574045
2,7,8-trimethylquinoline-4-carboxamide (PubChem CID 82574045) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is 2,7,8-trimethylquinoline-4-carboxamide.
| Compound Name | 2,7,8-trimethylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 82574045 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2,7,8-trimethylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(N)=O)c2ccc(C)c(C)c2n1 |
| InChI | InChI=1S/C13H14N2O/c1-7-4-5-10-11(13(14)16)6-8(2)15-12(10)9(7)3/h4-6H,1-3H3,(H2,14,16) |
| InChIKey | QPBSOEQKCFLCLO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |