C11H8F2N2O — CID 82574050
5,8-difluoro-2-methylquinoline-4-carboxamide (PubChem CID 82574050) has the molecular formula C11H8F2N2O and a molecular weight of 222.19 g/mol. Its IUPAC name is 5,8-difluoro-2-methylquinoline-4-carboxamide.
| Compound Name | 5,8-difluoro-2-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 82574050 |
| Molecular Formula | C11H8F2N2O |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 5,8-difluoro-2-methylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(N)=O)c2c(F)ccc(F)c2n1 |
| InChI | InChI=1S/C11H8F2N2O/c1-5-4-6(11(14)16)9-7(12)2-3-8(13)10(9)15-5/h2-4H,1H3,(H2,14,16) |
| InChIKey | QJLVKANFCRYEKU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |