C14H15F2N3 — CID 121236908
5,8-difluoro-2-methyl-4-piperazin-1-ylquinoline (PubChem CID 121236908) has the molecular formula C14H15F2N3 and a molecular weight of 263.29 g/mol. Its IUPAC name is 5,8-difluoro-2-methyl-4-piperazin-1-ylquinoline.
| Compound Name | 5,8-difluoro-2-methyl-4-piperazin-1-ylquinoline |
|---|---|
| PubChem CID | 121236908 |
| Molecular Formula | C14H15F2N3 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 5,8-difluoro-2-methyl-4-piperazin-1-ylquinoline |
| SMILES | Cc1cc(N2CCNCC2)c2c(F)ccc(F)c2n1 |
| InChI | InChI=1S/C14H15F2N3/c1-9-8-12(19-6-4-17-5-7-19)13-10(15)2-3-11(16)14(13)18-9/h2-3,8,17H,4-7H2,1H3 |
| InChIKey | QGZJAZWGTSDEHH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |