C14H16Cl3N3 — CID 121236949
6,8-dichloro-2-methyl-4-piperazin-1-ylquinoline;hydrochloride (PubChem CID 121236949) has the molecular formula C14H16Cl3N3 and a molecular weight of 332.66 g/mol. Its IUPAC name is 6,8-dichloro-2-methyl-4-piperazin-1-ylquinoline;hydrochloride.
| Compound Name | 6,8-dichloro-2-methyl-4-piperazin-1-ylquinoline;hydrochloride |
|---|---|
| PubChem CID | 121236949 |
| Molecular Formula | C14H16Cl3N3 |
| Molecular Weight | 332.66 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 6,8-dichloro-2-methyl-4-piperazin-1-ylquinoline;hydrochloride |
| SMILES | Cc1cc(N2CCNCC2)c2cc(Cl)cc(Cl)c2n1.Cl |
| InChI | InChI=1S/C14H15Cl2N3.ClH/c1-9-6-13(19-4-2-17-3-5-19)11-7-10(15)8-12(16)14(11)18-9;/h6-8,17H,2-5H2,1H3;1H |
| InChIKey | DNXUSBAJOHUUSU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |