About 5-chloro-2-methyl-4-piperazin-1-ylquinoline;2-methylquinoline
5-chloro-2-methyl-4-piperazin-1-ylquinoline;2-methylquinoline (PubChem CID 158334079) has the molecular formula C24H25ClN4
and a molecular weight of 404.95 g/mol. Its IUPAC name is 5-chloro-2-methyl-4-piperazin-1-ylquinoline;2-methylquinoline.
Molecular Properties
| Compound Name | 5-chloro-2-methyl-4-piperazin-1-ylquinoline;2-methylquinoline |
| PubChem CID | 158334079 |
| Molecular Formula | C24H25ClN4 |
| Molecular Weight | 404.95 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 5-chloro-2-methyl-4-piperazin-1-ylquinoline;2-methylquinoline |
| SMILES | Cc1cc(N2CCNCC2)c2c(Cl)cccc2n1.Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C14H16ClN3.C10H9N/c1-10-9-13(18-7-5-16-6-8-18)14-11(15)3-2-4-12(14)17-10;1-8-6-7-9-4-2-3-5-10(9)11-8/h2-4,9,16H,5-8H2,1H3;2-7H,1H3 |
| InChIKey | GQJFADIBZLGGJE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.95 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-2-methyl-4-piperazin-1-ylquinoline;2-methylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-methyl-4-piperazin-1-ylquinoline;2-methylquinoline?
The IUPAC name of 5-chloro-2-methyl-4-piperazin-1-ylquinoline;2-methylquinoline (CID 158334079) is 5-chloro-2-methyl-4-piperazin-1-ylquinoline;2-methylquinoline.
What is the SMILES notation for 5-chloro-2-methyl-4-piperazin-1-ylquinoline;2-methylquinoline?
The canonical SMILES for 5-chloro-2-methyl-4-piperazin-1-ylquinoline;2-methylquinoline is Cc1cc(N2CCNCC2)c2c(Cl)cccc2n1.Cc1ccc2ccccc2n1.
What is the InChIKey of 5-chloro-2-methyl-4-piperazin-1-ylquinoline;2-methylquinoline?
The InChIKey is GQJFADIBZLGGJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN3.C10H9N/c1-10-9-13(18-7-5-16-6-8-18)14-11(15)3-2-4-12(14)17-10;1-8-6-7-9-4-2-3-5-10(9)11-8/h2-4,9,16H,5-8H2,1H3;2-7H,1H3.
What are the key properties of 5-chloro-2-methyl-4-piperazin-1-ylquinoline;2-methylquinoline?
5-chloro-2-methyl-4-piperazin-1-ylquinoline;2-methylquinoline has a molecular weight of 404.95 g/mol, XLogP of 5.15, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methyl-4-piperazin-1-ylquinoline;2-methylquinoline is sourced from PubChem (CID 158334079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).