C11H6Cl2N2 — CID 82449362
6,8-dichloro-2-methylquinoline-4-carbonitrile (PubChem CID 82449362) has the molecular formula C11H6Cl2N2 and a molecular weight of 237.09 g/mol. Its IUPAC name is 6,8-dichloro-2-methylquinoline-4-carbonitrile.
| Compound Name | 6,8-dichloro-2-methylquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 82449362 |
| Molecular Formula | C11H6Cl2N2 |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 6,8-dichloro-2-methylquinoline-4-carbonitrile |
| SMILES | Cc1cc(C#N)c2cc(Cl)cc(Cl)c2n1 |
| InChI | InChI=1S/C11H6Cl2N2/c1-6-2-7(5-14)9-3-8(12)4-10(13)11(9)15-6/h2-4H,1H3 |
| InChIKey | ZGAYKZGQSGJJOX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |