C12H9ClN2 — CID 82573298
5-chloro-2,8-dimethylquinoline-4-carbonitrile (PubChem CID 82573298) has the molecular formula C12H9ClN2 and a molecular weight of 216.67 g/mol. Its IUPAC name is 5-chloro-2,8-dimethylquinoline-4-carbonitrile.
| Compound Name | 5-chloro-2,8-dimethylquinoline-4-carbonitrile |
|---|---|
| PubChem CID | 82573298 |
| Molecular Formula | C12H9ClN2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 5-chloro-2,8-dimethylquinoline-4-carbonitrile |
| SMILES | Cc1cc(C#N)c2c(Cl)ccc(C)c2n1 |
| InChI | InChI=1S/C12H9ClN2/c1-7-3-4-10(13)11-9(6-14)5-8(2)15-12(7)11/h3-5H,1-2H3 |
| InChIKey | VRXHITDYHNGTKT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |