C13H12ClNO — CID 82576214
1-(5-chloro-4,8-dimethylquinolin-2-yl)ethanone (PubChem CID 82576214) has the molecular formula C13H12ClNO and a molecular weight of 233.70 g/mol. Its IUPAC name is 1-(5-chloro-4,8-dimethylquinolin-2-yl)ethanone.
| Compound Name | 1-(5-chloro-4,8-dimethylquinolin-2-yl)ethanone |
|---|---|
| PubChem CID | 82576214 |
| Molecular Formula | C13H12ClNO |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 1-(5-chloro-4,8-dimethylquinolin-2-yl)ethanone |
| SMILES | CC(=O)c1cc(C)c2c(Cl)ccc(C)c2n1 |
| InChI | InChI=1S/C13H12ClNO/c1-7-4-5-10(14)12-8(2)6-11(9(3)16)15-13(7)12/h4-6H,1-3H3 |
| InChIKey | NWWSNCHKRUKOHX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |