C14H17ClN2 — CID 82576607
3-(5-chloro-4,8-dimethylquinolin-2-yl)propan-1-amine (PubChem CID 82576607) has the molecular formula C14H17ClN2 and a molecular weight of 248.76 g/mol. Its IUPAC name is 3-(5-chloro-4,8-dimethylquinolin-2-yl)propan-1-amine.
| Compound Name | 3-(5-chloro-4,8-dimethylquinolin-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 82576607 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 3-(5-chloro-4,8-dimethylquinolin-2-yl)propan-1-amine |
| SMILES | Cc1ccc(Cl)c2c(C)cc(CCCN)nc12 |
| InChI | InChI=1S/C14H17ClN2/c1-9-5-6-12(15)13-10(2)8-11(4-3-7-16)17-14(9)13/h5-6,8H,3-4,7,16H2,1-2H3 |
| InChIKey | ZARFTWFPCWCJGE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |