C11H16ClN — CID 84774719
3-(2-chloro-3,6-dimethylphenyl)propan-1-amine (PubChem CID 84774719) has the molecular formula C11H16ClN and a molecular weight of 197.71 g/mol. Its IUPAC name is 3-(2-chloro-3,6-dimethylphenyl)propan-1-amine.
| Compound Name | 3-(2-chloro-3,6-dimethylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 84774719 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 3-(2-chloro-3,6-dimethylphenyl)propan-1-amine |
| SMILES | Cc1ccc(C)c(CCCN)c1Cl |
| InChI | InChI=1S/C11H16ClN/c1-8-5-6-9(2)11(12)10(8)4-3-7-13/h5-6H,3-4,7,13H2,1-2H3 |
| InChIKey | QTQQLSCNTVFPAY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |