C12H13ClN2 — CID 82242202
(5-chloro-3,8-dimethylquinolin-2-yl)methanamine (PubChem CID 82242202) has the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. Its IUPAC name is (5-chloro-3,8-dimethylquinolin-2-yl)methanamine.
| Compound Name | (5-chloro-3,8-dimethylquinolin-2-yl)methanamine |
|---|---|
| PubChem CID | 82242202 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (5-chloro-3,8-dimethylquinolin-2-yl)methanamine |
| SMILES | Cc1cc2c(Cl)ccc(C)c2nc1CN |
| InChI | InChI=1S/C12H13ClN2/c1-7-3-4-10(13)9-5-8(2)11(6-14)15-12(7)9/h3-5H,6,14H2,1-2H3 |
| InChIKey | GGYFUUDDNUMWHZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |