About (8-fluoro-2,5-dimethylquinolin-4-yl)hydrazine
(8-fluoro-2,5-dimethylquinolin-4-yl)hydrazine (PubChem CID 62252255) has the molecular formula C11H12FN3
and a molecular weight of 205.24 g/mol. Its IUPAC name is (8-fluoro-2,5-dimethylquinolin-4-yl)hydrazine.
Molecular Properties
| Compound Name | (8-fluoro-2,5-dimethylquinolin-4-yl)hydrazine |
| PubChem CID | 62252255 |
| Molecular Formula | C11H12FN3 |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (8-fluoro-2,5-dimethylquinolin-4-yl)hydrazine |
| SMILES | Cc1cc(NN)c2c(C)ccc(F)c2n1 |
| InChI | InChI=1S/C11H12FN3/c1-6-3-4-8(12)11-10(6)9(15-13)5-7(2)14-11/h3-5H,13H2,1-2H3,(H,14,15) |
| InChIKey | DVIPIWXJPHUISF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (8-fluoro-2,5-dimethylquinolin-4-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-fluoro-2,5-dimethylquinolin-4-yl)hydrazine?
The IUPAC name of (8-fluoro-2,5-dimethylquinolin-4-yl)hydrazine (CID 62252255) is (8-fluoro-2,5-dimethylquinolin-4-yl)hydrazine.
What is the SMILES notation for (8-fluoro-2,5-dimethylquinolin-4-yl)hydrazine?
The canonical SMILES for (8-fluoro-2,5-dimethylquinolin-4-yl)hydrazine is Cc1cc(NN)c2c(C)ccc(F)c2n1.
What is the InChIKey of (8-fluoro-2,5-dimethylquinolin-4-yl)hydrazine?
The InChIKey is DVIPIWXJPHUISF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FN3/c1-6-3-4-8(12)11-10(6)9(15-13)5-7(2)14-11/h3-5H,13H2,1-2H3,(H,14,15).
What are the key properties of (8-fluoro-2,5-dimethylquinolin-4-yl)hydrazine?
(8-fluoro-2,5-dimethylquinolin-4-yl)hydrazine has a molecular weight of 205.24 g/mol, XLogP of 2.28, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8-fluoro-2,5-dimethylquinolin-4-yl)hydrazine is sourced from PubChem (CID 62252255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).