C20H24F3N3O — CID 134713018
4-[1-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]piperidin-4-yl]morpholine (PubChem CID 134713018) has the molecular formula C20H24F3N3O and a molecular weight of 379.43 g/mol. Its IUPAC name is 4-[1-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]piperidin-4-yl]morpholine.
| Compound Name | 4-[1-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]piperidin-4-yl]morpholine |
|---|---|
| PubChem CID | 134713018 |
| Molecular Formula | C20H24F3N3O |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 4-[1-[2-methyl-7-(trifluoromethyl)quinolin-4-yl]piperidin-4-yl]morpholine |
| SMILES | Cc1cc(N2CCC(N3CCOCC3)CC2)c2ccc(C(F)(F)F)cc2n1 |
| InChI | InChI=1S/C20H24F3N3O/c1-14-12-19(17-3-2-15(20(21,22)23)13-18(17)24-14)26-6-4-16(5-7-26)25-8-10-27-11-9-25/h2-3,12-13,16H,4-11H2,1H3 |
| InChIKey | WXZIOQLHSBNKID-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |