C15H16F3N2O+ — CID 7730550
4-[2-methyl-7-(trifluoromethyl)quinolin-1-ium-4-yl]morpholine (PubChem CID 7730550) has the molecular formula C15H16F3N2O+ and a molecular weight of 297.30 g/mol. Its IUPAC name is 4-[2-methyl-7-(trifluoromethyl)quinolin-1-ium-4-yl]morpholine.
| Compound Name | 4-[2-methyl-7-(trifluoromethyl)quinolin-1-ium-4-yl]morpholine |
|---|---|
| PubChem CID | 7730550 |
| Molecular Formula | C15H16F3N2O+ |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 4-[2-methyl-7-(trifluoromethyl)quinolin-1-ium-4-yl]morpholine |
| SMILES | Cc1cc(N2CCOCC2)c2ccc(C(F)(F)F)cc2[nH+]1 |
| InChI | InChI=1S/C15H15F3N2O/c1-10-8-14(20-4-6-21-7-5-20)12-3-2-11(15(16,17)18)9-13(12)19-10/h2-3,8-9H,4-7H2,1H3/p+1 |
| InChIKey | WUYFYMMHEIVRKB-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 26.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |