C12H10N4 — CID 123772514
1-(4-ethenyl-2-isocyano-6-methylphenyl)-1,2,4-triazole (PubChem CID 123772514) has the molecular formula C12H10N4 and a molecular weight of 210.24 g/mol. Its IUPAC name is 1-(4-ethenyl-2-isocyano-6-methylphenyl)-1,2,4-triazole.
| Compound Name | 1-(4-ethenyl-2-isocyano-6-methylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 123772514 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 1-(4-ethenyl-2-isocyano-6-methylphenyl)-1,2,4-triazole |
| SMILES | [C-]#[N+]c1cc(C=C)cc(C)c1-n1cncn1 |
| InChI | InChI=1S/C12H10N4/c1-4-10-5-9(2)12(11(6-10)13-3)16-8-14-7-15-16/h4-8H,1H2,2H3 |
| InChIKey | ZOTXEVYHOJMSFX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 35.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|