C22H16ClF7N2O2 — CID 118070130
methyl 2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]pyrazol-4-yl]benzoate (PubChem CID 118070130) has the molecular formula C22H16ClF7N2O2 and a molecular weight of 508.82 g/mol. Its IUPAC name is methyl 2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]pyrazol-4-yl]benzoate.
| Compound Name | methyl 2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]pyrazol-4-yl]benzoate |
|---|---|
| PubChem CID | 118070130 |
| Molecular Formula | C22H16ClF7N2O2 |
| Molecular Weight | 508.82 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | methyl 2-chloro-5-[1-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]pyrazol-4-yl]benzoate |
| SMILES | COC(=O)c1cc(-c2cnn(-c3c(C)cc(C(F)(C(F)(F)F)C(F)(F)F)cc3C)c2)ccc1Cl |
| InChI | InChI=1S/C22H16ClF7N2O2/c1-11-6-15(20(24,21(25,26)27)22(28,29)30)7-12(2)18(11)32-10-14(9-31-32)13-4-5-17(23)16(8-13)19(33)34-3/h4-10H,1-3H3 |
| InChIKey | VTOMOWQXPFEOGB-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.82 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |