C18H6Cl3F8N3O — CID 175409938
5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]-2-fluoropyridine-3-carbonyl chloride (PubChem CID 175409938) has the molecular formula C18H6Cl3F8N3O and a molecular weight of 538.61 g/mol. Its IUPAC name is 5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]-2-fluoropyridine-3-carbonyl chloride.
| Compound Name | 5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]-2-fluoropyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 175409938 |
| Molecular Formula | C18H6Cl3F8N3O |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 536.94 |
| IUPAC Name | 5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]-2-fluoropyridine-3-carbonyl chloride |
| SMILES | O=C(Cl)c1cc(-c2cnn(-c3c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc3Cl)c2)cnc1F |
| InChI | InChI=1S/C18H6Cl3F8N3O/c19-11-2-9(16(23,17(24,25)26)18(27,28)29)3-12(20)13(11)32-6-8(5-31-32)7-1-10(14(21)33)15(22)30-4-7/h1-6H |
| InChIKey | GEMNDTKEAHAFKG-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|