C26H20Cl3F7N4O — CID 171476085
2-chloro-N-cyclopropyl-N-(2-cyclopropylethyl)-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]pyridine-3-carboxamide (PubChem CID 171476085) has the molecular formula C26H20Cl3F7N4O and a molecular weight of 643.82 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-N-(2-cyclopropylethyl)-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-cyclopropyl-N-(2-cyclopropylethyl)-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171476085 |
| Molecular Formula | C26H20Cl3F7N4O |
| Molecular Weight | 643.82 g/mol |
| Exact Mass | 642.06 |
| IUPAC Name | 2-chloro-N-cyclopropyl-N-(2-cyclopropylethyl)-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]pyridine-3-carboxamide |
| SMILES | O=C(c1cc(-c2cnn(-c3c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc3Cl)c2)cnc1Cl)N(CCC1CC1)C1CC1 |
| InChI | InChI=1S/C26H20Cl3F7N4O/c27-19-8-16(24(30,25(31,32)33)26(34,35)36)9-20(28)21(19)40-12-15(11-38-40)14-7-18(22(29)37-10-14)23(41)39(17-3-4-17)6-5-13-1-2-13/h7-13,17H,1-6H2 |
| InChIKey | XVZMRRPFKIXOIB-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.82 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|