C30H20Cl3F7N4O3 — CID 175572612
benzyl 2-[[2-chloro-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]pyridine-3-carbonyl]-cyclopropylamino]acetate (PubChem CID 175572612) has the molecular formula C30H20Cl3F7N4O3 and a molecular weight of 723.86 g/mol. Its IUPAC name is benzyl 2-[[2-chloro-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]pyridine-3-carbonyl]-cyclopropylamino]acetate.
| Compound Name | benzyl 2-[[2-chloro-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]pyridine-3-carbonyl]-cyclopropylamino]acetate |
|---|---|
| PubChem CID | 175572612 |
| Molecular Formula | C30H20Cl3F7N4O3 |
| Molecular Weight | 723.86 g/mol |
| Exact Mass | 722.05 |
| IUPAC Name | benzyl 2-[[2-chloro-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]pyridine-3-carbonyl]-cyclopropylamino]acetate |
| SMILES | O=C(CN(C(=O)c1cc(-c2cnn(-c3c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc3Cl)c2)cnc1Cl)C1CC1)OCc1ccccc1 |
| InChI | InChI=1S/C30H20Cl3F7N4O3/c31-22-9-19(28(34,29(35,36)37)30(38,39)40)10-23(32)25(22)44-13-18(12-42-44)17-8-21(26(33)41-11-17)27(46)43(20-6-7-20)14-24(45)47-15-16-4-2-1-3-5-16/h1-5,8-13,20H,6-7,14-15H2 |
| InChIKey | UDMGIQSKVANMCR-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.86 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|