C25H15ClF10N4O3 — CID 175736562
2-[1-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]pyrazol-4-yl]-N-(1-cyanocyclopropyl)-N-(hydroxymethyl)benzamide (PubChem CID 175736562) has the molecular formula C25H15ClF10N4O3 and a molecular weight of 644.85 g/mol. Its IUPAC name is 2-[1-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]pyrazol-4-yl]-N-(1-cyanocyclopropyl)-N-(hydroxymethyl)benzamide.
| Compound Name | 2-[1-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]pyrazol-4-yl]-N-(1-cyanocyclopropyl)-N-(hydroxymethyl)benzamide |
|---|---|
| PubChem CID | 175736562 |
| Molecular Formula | C25H15ClF10N4O3 |
| Molecular Weight | 644.85 g/mol |
| Exact Mass | 644.07 |
| IUPAC Name | 2-[1-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]pyrazol-4-yl]-N-(1-cyanocyclopropyl)-N-(hydroxymethyl)benzamide |
| SMILES | N#CC1(N(CO)C(=O)c2ccccc2-c2cnn(-c3c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc3OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C25H15ClF10N4O3/c26-17-7-14(22(27,23(28,29)30)24(31,32)33)8-18(43-25(34,35)36)19(17)40-10-13(9-38-40)15-3-1-2-4-16(15)20(42)39(12-41)21(11-37)5-6-21/h1-4,7-10,41H,5-6,12H2 |
| InChIKey | NQBZWUQTANSHIF-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.85 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|