C34H19Cl2F10N3O6 — CID 165165714
4-[[[2-chloro-5-[1-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]pyrrol-3-yl]benzoyl]-(1-cyanocyclopropyl)amino]methoxycarbonyl]benzoic acid (PubChem CID 165165714) has the molecular formula C34H19Cl2F10N3O6 and a molecular weight of 826.43 g/mol. Its IUPAC name is 4-[[[2-chloro-5-[1-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]pyrrol-3-yl]benzoyl]-(1-cyanocyclopropyl)amino]methoxycarbonyl]benzoic acid.
| Compound Name | 4-[[[2-chloro-5-[1-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]pyrrol-3-yl]benzoyl]-(1-cyanocyclopropyl)amino]methoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 165165714 |
| Molecular Formula | C34H19Cl2F10N3O6 |
| Molecular Weight | 826.43 g/mol |
| Exact Mass | 825.05 |
| IUPAC Name | 4-[[[2-chloro-5-[1-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]pyrrol-3-yl]benzoyl]-(1-cyanocyclopropyl)amino]methoxycarbonyl]benzoic acid |
| SMILES | N#CC1(N(COC(=O)c2ccc(C(=O)O)cc2)C(=O)c2cc(-c3ccn(-c4c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc4OC(F)(F)F)c3)ccc2Cl)CC1 |
| InChI | InChI=1S/C34H19Cl2F10N3O6/c35-23-6-5-19(11-22(23)27(50)49(30(15-47)8-9-30)16-54-29(53)18-3-1-17(2-4-18)28(51)52)20-7-10-48(14-20)26-24(36)12-21(13-25(26)55-34(44,45)46)31(37,32(38,39)40)33(41,42)43/h1-7,10-14H,8-9,16H2,(H,51,52) |
| InChIKey | IDMWTOCUZSZYMB-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.43 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|