C29H18Cl2F10N4O6 — CID 155796468
4-[[[2-chloro-5-[1-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]pyrazol-4-yl]benzoyl]-(1-cyanocyclopropyl)amino]methoxy]-4-oxobutanoic acid (PubChem CID 155796468) has the molecular formula C29H18Cl2F10N4O6 and a molecular weight of 779.37 g/mol. Its IUPAC name is 4-[[[2-chloro-5-[1-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]pyrazol-4-yl]benzoyl]-(1-cyanocyclopropyl)amino]methoxy]-4-oxobutanoic acid.
| Compound Name | 4-[[[2-chloro-5-[1-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]pyrazol-4-yl]benzoyl]-(1-cyanocyclopropyl)amino]methoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 155796468 |
| Molecular Formula | C29H18Cl2F10N4O6 |
| Molecular Weight | 779.37 g/mol |
| Exact Mass | 778.04 |
| IUPAC Name | 4-[[[2-chloro-5-[1-[2-chloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethoxy)phenyl]pyrazol-4-yl]benzoyl]-(1-cyanocyclopropyl)amino]methoxy]-4-oxobutanoic acid |
| SMILES | N#CC1(N(COC(=O)CCC(=O)O)C(=O)c2cc(-c3cnn(-c4c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc4OC(F)(F)F)c3)ccc2Cl)CC1 |
| InChI | InChI=1S/C29H18Cl2F10N4O6/c30-18-2-1-14(7-17(18)24(49)44(25(12-42)5-6-25)13-50-22(48)4-3-21(46)47)15-10-43-45(11-15)23-19(31)8-16(9-20(23)51-29(39,40)41)26(32,27(33,34)35)28(36,37)38/h1-2,7-11H,3-6,13H2,(H,46,47) |
| InChIKey | TUAAQWXMEJIECJ-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 134.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.37 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|