C28H25Cl3F7N5O2 — CID 175572614
2-chloro-N-cyclopropyl-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]-N-[di(propan-2-yl)carbamoyl]pyridine-3-carboxamide (PubChem CID 175572614) has the molecular formula C28H25Cl3F7N5O2 and a molecular weight of 702.89 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]-N-[di(propan-2-yl)carbamoyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-cyclopropyl-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]-N-[di(propan-2-yl)carbamoyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175572614 |
| Molecular Formula | C28H25Cl3F7N5O2 |
| Molecular Weight | 702.89 g/mol |
| Exact Mass | 701.10 |
| IUPAC Name | 2-chloro-N-cyclopropyl-5-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]-N-[di(propan-2-yl)carbamoyl]pyridine-3-carboxamide |
| SMILES | CC(C)N(C(=O)N(C(=O)c1cc(-c2cnn(-c3c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc3Cl)c2)cnc1Cl)C1CC1)C(C)C |
| InChI | InChI=1S/C28H25Cl3F7N5O2/c1-13(2)42(14(3)4)25(45)43(18-5-6-18)24(44)19-7-15(10-39-23(19)31)16-11-40-41(12-16)22-20(29)8-17(9-21(22)30)26(32,27(33,34)35)28(36,37)38/h7-14,18H,5-6H2,1-4H3 |
| InChIKey | VTWCMWYNUGWPTG-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.89 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|