C24H21ClF9N5O3 — CID 137481522
2-chloro-N-cyclopropyl-5-[1-[4-(difluoromethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrazol-5-yl]pyrazol-4-yl]-N-(ethoxymethyl)benzamide (PubChem CID 137481522) has the molecular formula C24H21ClF9N5O3 and a molecular weight of 633.90 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-5-[1-[4-(difluoromethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrazol-5-yl]pyrazol-4-yl]-N-(ethoxymethyl)benzamide.
| Compound Name | 2-chloro-N-cyclopropyl-5-[1-[4-(difluoromethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrazol-5-yl]pyrazol-4-yl]-N-(ethoxymethyl)benzamide |
|---|---|
| PubChem CID | 137481522 |
| Molecular Formula | C24H21ClF9N5O3 |
| Molecular Weight | 633.90 g/mol |
| Exact Mass | 633.12 |
| IUPAC Name | 2-chloro-N-cyclopropyl-5-[1-[4-(difluoromethoxy)-3-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-methylpyrazol-5-yl]pyrazol-4-yl]-N-(ethoxymethyl)benzamide |
| SMILES | CCOCN(C(=O)c1cc(-c2cnn(-c3c(OC(F)F)c(C(F)(C(F)(F)F)C(F)(F)F)nn3C)c2)ccc1Cl)C1CC1 |
| InChI | InChI=1S/C24H21ClF9N5O3/c1-3-41-11-38(14-5-6-14)20(40)15-8-12(4-7-16(15)25)13-9-35-39(10-13)19-17(42-21(26)27)18(36-37(19)2)22(28,23(29,30)31)24(32,33)34/h4,7-10,14,21H,3,5-6,11H2,1-2H3 |
| InChIKey | ZCWFQILPLCOUEU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 74.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.90 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|