C21H21F7N6O2 — CID 162606153
N-cyclopropyl-3-[1-[4-(difluoromethoxy)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]pyrazol-4-yl]-N,6-dimethyl-1,2-dihydropyridine-5-carboxamide (PubChem CID 162606153) has the molecular formula C21H21F7N6O2 and a molecular weight of 522.43 g/mol. Its IUPAC name is N-cyclopropyl-3-[1-[4-(difluoromethoxy)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]pyrazol-4-yl]-N,6-dimethyl-1,2-dihydropyridine-5-carboxamide.
| Compound Name | N-cyclopropyl-3-[1-[4-(difluoromethoxy)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]pyrazol-4-yl]-N,6-dimethyl-1,2-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 162606153 |
| Molecular Formula | C21H21F7N6O2 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | N-cyclopropyl-3-[1-[4-(difluoromethoxy)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]pyrazol-4-yl]-N,6-dimethyl-1,2-dihydropyridine-5-carboxamide |
| SMILES | CC1=C(C(=O)N(C)C2CC2)C=C(c2cnn(-c3c(OC(F)F)c(C(F)(F)C(F)(F)F)nn3C)c2)CN1 |
| InChI | InChI=1S/C21H21F7N6O2/c1-10-14(18(35)32(2)13-4-5-13)6-11(7-29-10)12-8-30-34(9-12)17-15(36-19(22)23)16(31-33(17)3)20(24,25)21(26,27)28/h6,8-9,13,19,29H,4-5,7H2,1-3H3 |
| InChIKey | GEROWYOFEJXLSK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|