C22H14ClF12N5O2 — CID 130357088
2-chloro-N-cyclopropyl-5-[1-[4-(1,1,2,2,3,3,3-heptafluoropropoxy)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]pyrazol-4-yl]benzamide (PubChem CID 130357088) has the molecular formula C22H14ClF12N5O2 and a molecular weight of 643.82 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-5-[1-[4-(1,1,2,2,3,3,3-heptafluoropropoxy)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]pyrazol-4-yl]benzamide.
| Compound Name | 2-chloro-N-cyclopropyl-5-[1-[4-(1,1,2,2,3,3,3-heptafluoropropoxy)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 130357088 |
| Molecular Formula | C22H14ClF12N5O2 |
| Molecular Weight | 643.82 g/mol |
| Exact Mass | 643.06 |
| IUPAC Name | 2-chloro-N-cyclopropyl-5-[1-[4-(1,1,2,2,3,3,3-heptafluoropropoxy)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]pyrazol-4-yl]benzamide |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(OC(F)(F)C(F)(F)C(F)(F)F)c1-n1cc(-c2ccc(Cl)c(C(=O)NC3CC3)c2)cn1 |
| InChI | InChI=1S/C22H14ClF12N5O2/c1-39-17(40-8-10(7-36-40)9-2-5-13(23)12(6-9)16(41)37-11-3-4-11)14(15(38-39)18(24,25)20(28,29)30)42-22(34,35)19(26,27)21(31,32)33/h2,5-8,11H,3-4H2,1H3,(H,37,41) |
| InChIKey | CJNSOETXLMJJNP-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.82 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|