C21H15ClF5N5O — CID 130356970
2-chloro-N-cyclopropyl-5-[1-[4-ethynyl-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]pyrazol-4-yl]benzamide (PubChem CID 130356970) has the molecular formula C21H15ClF5N5O and a molecular weight of 483.83 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-5-[1-[4-ethynyl-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]pyrazol-4-yl]benzamide.
| Compound Name | 2-chloro-N-cyclopropyl-5-[1-[4-ethynyl-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 130356970 |
| Molecular Formula | C21H15ClF5N5O |
| Molecular Weight | 483.83 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 2-chloro-N-cyclopropyl-5-[1-[4-ethynyl-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-yl]pyrazol-4-yl]benzamide |
| SMILES | C#Cc1c(C(F)(F)C(F)(F)F)nn(C)c1-n1cc(-c2ccc(Cl)c(C(=O)NC3CC3)c2)cn1 |
| InChI | InChI=1S/C21H15ClF5N5O/c1-3-14-17(20(23,24)21(25,26)27)30-31(2)19(14)32-10-12(9-28-32)11-4-7-16(22)15(8-11)18(33)29-13-5-6-13/h1,4,7-10,13H,5-6H2,2H3,(H,29,33) |
| InChIKey | GKXUIWXRDJHLJB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.83 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|