C22H17ClF8N6O — CID 146927096
2-chloro-N-(4-cyanobutyl)-5-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]benzamide (PubChem CID 146927096) has the molecular formula C22H17ClF8N6O and a molecular weight of 568.86 g/mol. Its IUPAC name is 2-chloro-N-(4-cyanobutyl)-5-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]benzamide.
| Compound Name | 2-chloro-N-(4-cyanobutyl)-5-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 146927096 |
| Molecular Formula | C22H17ClF8N6O |
| Molecular Weight | 568.86 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | 2-chloro-N-(4-cyanobutyl)-5-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]benzamide |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1-n1cc(-c2ccc(Cl)c(C(=O)NCCCCC#N)c2)cn1 |
| InChI | InChI=1S/C22H17ClF8N6O/c1-36-19(16(21(26,27)28)17(35-36)20(24,25)22(29,30)31)37-11-13(10-34-37)12-5-6-15(23)14(9-12)18(38)33-8-4-2-3-7-32/h5-6,9-11H,2-4,8H2,1H3,(H,33,38) |
| InChIKey | AEHCYLYIAKHHLG-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.86 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|