C32H31ClF8N6O5 — CID 155592226
1-O-tert-butyl 4-O-[[[2-chloro-5-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]benzoyl]-(1-cyanocyclopropyl)amino]methyl] 2,2-dimethylbutanedioate (PubChem CID 155592226) has the molecular formula C32H31ClF8N6O5 and a molecular weight of 767.07 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-[[[2-chloro-5-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]benzoyl]-(1-cyanocyclopropyl)amino]methyl] 2,2-dimethylbutanedioate.
| Compound Name | 1-O-tert-butyl 4-O-[[[2-chloro-5-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]benzoyl]-(1-cyanocyclopropyl)amino]methyl] 2,2-dimethylbutanedioate |
|---|---|
| PubChem CID | 155592226 |
| Molecular Formula | C32H31ClF8N6O5 |
| Molecular Weight | 767.07 g/mol |
| Exact Mass | 766.19 |
| IUPAC Name | 1-O-tert-butyl 4-O-[[[2-chloro-5-[1-[1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazol-5-yl]pyrazol-4-yl]benzoyl]-(1-cyanocyclopropyl)amino]methyl] 2,2-dimethylbutanedioate |
| SMILES | Cn1nc(C(F)(F)C(F)(F)F)c(C(F)(F)F)c1-n1cc(-c2ccc(Cl)c(C(=O)N(COC(=O)CC(C)(C)C(=O)OC(C)(C)C)C3(C#N)CC3)c2)cn1 |
| InChI | InChI=1S/C32H31ClF8N6O5/c1-27(2,3)52-26(50)28(4,5)12-21(48)51-16-46(29(15-42)9-10-29)25(49)19-11-17(7-8-20(19)33)18-13-43-47(14-18)24-22(31(36,37)38)23(44-45(24)6)30(34,35)32(39,40)41/h7-8,11,13-14H,9-10,12,16H2,1-6H3 |
| InChIKey | GUILOHGUARRTCY-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 132.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.07 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|