C23H15ClF10N6O4S — CID 142500920
[5-[4-[4-chloro-3-[(1-cyanocyclopropyl)-methylcarbamoyl]phenyl]pyrazol-1-yl]-1-methyl-4-(trifluoromethyl)pyrazol-3-yl] 1,1,1,2,3,3,3-heptafluoropropane-2-sulfonate (PubChem CID 142500920) has the molecular formula C23H15ClF10N6O4S and a molecular weight of 696.91 g/mol. Its IUPAC name is [5-[4-[4-chloro-3-[(1-cyanocyclopropyl)-methylcarbamoyl]phenyl]pyrazol-1-yl]-1-methyl-4-(trifluoromethyl)pyrazol-3-yl] 1,1,1,2,3,3,3-heptafluoropropane-2-sulfonate.
| Compound Name | [5-[4-[4-chloro-3-[(1-cyanocyclopropyl)-methylcarbamoyl]phenyl]pyrazol-1-yl]-1-methyl-4-(trifluoromethyl)pyrazol-3-yl] 1,1,1,2,3,3,3-heptafluoropropane-2-sulfonate |
|---|---|
| PubChem CID | 142500920 |
| Molecular Formula | C23H15ClF10N6O4S |
| Molecular Weight | 696.91 g/mol |
| Exact Mass | 696.04 |
| IUPAC Name | [5-[4-[4-chloro-3-[(1-cyanocyclopropyl)-methylcarbamoyl]phenyl]pyrazol-1-yl]-1-methyl-4-(trifluoromethyl)pyrazol-3-yl] 1,1,1,2,3,3,3-heptafluoropropane-2-sulfonate |
| SMILES | CN(C(=O)c1cc(-c2cnn(-c3c(C(F)(F)F)c(OS(=O)(=O)C(F)(C(F)(F)F)C(F)(F)F)nn3C)c2)ccc1Cl)C1(C#N)CC1 |
| InChI | InChI=1S/C23H15ClF10N6O4S/c1-38(19(10-35)5-6-19)18(41)13-7-11(3-4-14(13)24)12-8-36-40(9-12)17-15(20(25,26)27)16(37-39(17)2)44-45(42,43)21(28,22(29,30)31)23(32,33)34/h3-4,7-9H,5-6H2,1-2H3 |
| InChIKey | DILLCXPQNSYOKQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 123.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.91 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|