C22H13BrClF9N4O2 — CID 178170864
5-[1-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]-2-chloro-N-cyclopropylpyridine-3-carboxamide (PubChem CID 178170864) has the molecular formula C22H13BrClF9N4O2 and a molecular weight of 651.71 g/mol. Its IUPAC name is 5-[1-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]-2-chloro-N-cyclopropylpyridine-3-carboxamide.
| Compound Name | 5-[1-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]-2-chloro-N-cyclopropylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 178170864 |
| Molecular Formula | C22H13BrClF9N4O2 |
| Molecular Weight | 651.71 g/mol |
| Exact Mass | 649.98 |
| IUPAC Name | 5-[1-[2-bromo-6-(difluoromethoxy)-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]-2-chloro-N-cyclopropylpyridine-3-carboxamide |
| SMILES | O=C(NC1CC1)c1cc(-c2cnn(-c3c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc3OC(F)F)c2)cnc1Cl |
| InChI | InChI=1S/C22H13BrClF9N4O2/c23-14-4-11(20(27,21(28,29)30)22(31,32)33)5-15(39-19(25)26)16(14)37-8-10(7-35-37)9-3-13(17(24)34-6-9)18(38)36-12-1-2-12/h3-8,12,19H,1-2H2,(H,36,38) |
| InChIKey | IIDOSQOHRXLCIA-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.71 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|