C23H18Cl2F7N3O — CID 126595315
N-[[3-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]phenyl]methyl]-N-methylpropanamide (PubChem CID 126595315) has the molecular formula C23H18Cl2F7N3O and a molecular weight of 556.31 g/mol. Its IUPAC name is N-[[3-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]phenyl]methyl]-N-methylpropanamide.
| Compound Name | N-[[3-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]phenyl]methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 126595315 |
| Molecular Formula | C23H18Cl2F7N3O |
| Molecular Weight | 556.31 g/mol |
| Exact Mass | 555.07 |
| IUPAC Name | N-[[3-[1-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrazol-4-yl]phenyl]methyl]-N-methylpropanamide |
| SMILES | CCC(=O)N(C)Cc1cccc(-c2cnn(-c3c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc3Cl)c2)c1 |
| InChI | InChI=1S/C23H18Cl2F7N3O/c1-3-19(36)34(2)11-13-5-4-6-14(7-13)15-10-33-35(12-15)20-17(24)8-16(9-18(20)25)21(26,22(27,28)29)23(30,31)32/h4-10,12H,3,11H2,1-2H3 |
| InChIKey | GYRXCMUOUKFCCE-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.31 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |