C27H13Cl2F9N4O — CID 152934782
4-[2-[3-[1-[2,6-dichloro-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]triazol-4-yl]phenyl]acetyl]benzonitrile (PubChem CID 152934782) has the molecular formula C27H13Cl2F9N4O and a molecular weight of 651.32 g/mol. Its IUPAC name is 4-[2-[3-[1-[2,6-dichloro-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]triazol-4-yl]phenyl]acetyl]benzonitrile.
| Compound Name | 4-[2-[3-[1-[2,6-dichloro-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]triazol-4-yl]phenyl]acetyl]benzonitrile |
|---|---|
| PubChem CID | 152934782 |
| Molecular Formula | C27H13Cl2F9N4O |
| Molecular Weight | 651.32 g/mol |
| Exact Mass | 650.03 |
| IUPAC Name | 4-[2-[3-[1-[2,6-dichloro-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]triazol-4-yl]phenyl]acetyl]benzonitrile |
| SMILES | N#Cc1ccc(C(=O)Cc2cccc(-c3cn(-c4c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc4Cl)nn3)c2)cc1 |
| InChI | InChI=1S/C27H13Cl2F9N4O/c28-19-10-18(24(30,26(33,34)35)25(31,32)27(36,37)38)11-20(29)23(19)42-13-21(40-41-42)17-3-1-2-15(8-17)9-22(43)16-6-4-14(12-39)5-7-16/h1-8,10-11,13H,9H2 |
| InChIKey | ULQSJRDRKOKYIW-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.32 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|