C26H16Cl2F9N5O — CID 147052446
N-[3-[(Z)-1-amino-2-[N-amino-2,6-dichloro-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)anilino]ethenyl]phenyl]-4-cyanobenzamide (PubChem CID 147052446) has the molecular formula C26H16Cl2F9N5O and a molecular weight of 656.34 g/mol. Its IUPAC name is N-[3-[(Z)-1-amino-2-[N-amino-2,6-dichloro-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)anilino]ethenyl]phenyl]-4-cyanobenzamide.
| Compound Name | N-[3-[(Z)-1-amino-2-[N-amino-2,6-dichloro-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)anilino]ethenyl]phenyl]-4-cyanobenzamide |
|---|---|
| PubChem CID | 147052446 |
| Molecular Formula | C26H16Cl2F9N5O |
| Molecular Weight | 656.34 g/mol |
| Exact Mass | 655.06 |
| IUPAC Name | N-[3-[(Z)-1-amino-2-[N-amino-2,6-dichloro-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)anilino]ethenyl]phenyl]-4-cyanobenzamide |
| SMILES | N#Cc1ccc(C(=O)Nc2cccc(/C(N)=C/N(N)c3c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc3Cl)c2)cc1 |
| InChI | InChI=1S/C26H16Cl2F9N5O/c27-18-9-16(23(29,25(32,33)34)24(30,31)26(35,36)37)10-19(28)21(18)42(40)12-20(39)15-2-1-3-17(8-15)41-22(43)14-6-4-13(11-38)5-7-14/h1-10,12H,39-40H2,(H,41,43)/b20-12- |
| InChIKey | BBOVCTLDVWNYMG-NDENLUEZSA-N |
| XLogP | 7.68 |
| TPSA | 108.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.34 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|