C27H14Cl2F10N4O2 — CID 142797418
4-cyano-5-[(4-cyano-2-methylbenzoyl)amino]-5-[2,6-dichloro-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-6-fluorocyclohexa-1,3-diene-1-carboxamide (PubChem CID 142797418) has the molecular formula C27H14Cl2F10N4O2 and a molecular weight of 687.32 g/mol. Its IUPAC name is 4-cyano-5-[(4-cyano-2-methylbenzoyl)amino]-5-[2,6-dichloro-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-6-fluorocyclohexa-1,3-diene-1-carboxamide.
| Compound Name | 4-cyano-5-[(4-cyano-2-methylbenzoyl)amino]-5-[2,6-dichloro-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-6-fluorocyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 142797418 |
| Molecular Formula | C27H14Cl2F10N4O2 |
| Molecular Weight | 687.32 g/mol |
| Exact Mass | 686.03 |
| IUPAC Name | 4-cyano-5-[(4-cyano-2-methylbenzoyl)amino]-5-[2,6-dichloro-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)phenyl]-6-fluorocyclohexa-1,3-diene-1-carboxamide |
| SMILES | Cc1cc(C#N)ccc1C(=O)NC1(c2c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc2Cl)C(C#N)=CC=C(C(N)=O)C1F |
| InChI | InChI=1S/C27H14Cl2F10N4O2/c1-11-6-12(9-40)2-4-15(11)22(45)43-23(13(10-41)3-5-16(20(23)30)21(42)44)19-17(28)7-14(8-18(19)29)24(31,26(34,35)36)25(32,33)27(37,38)39/h2-8,20H,1H3,(H2,42,44)(H,43,45) |
| InChIKey | WHEVLGWWRIPHLX-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.32 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|