C26H11F13IN3O2 — CID 87288830
3-[(3-cyanobenzoyl)amino]-2-fluoro-N-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]benzamide (PubChem CID 87288830) has the molecular formula C26H11F13IN3O2 and a molecular weight of 771.27 g/mol. Its IUPAC name is 3-[(3-cyanobenzoyl)amino]-2-fluoro-N-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[(3-cyanobenzoyl)amino]-2-fluoro-N-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 87288830 |
| Molecular Formula | C26H11F13IN3O2 |
| Molecular Weight | 771.27 g/mol |
| Exact Mass | 770.97 |
| IUPAC Name | 3-[(3-cyanobenzoyl)amino]-2-fluoro-N-[2-iodo-4-(1,1,1,2,3,3,4,4,4-nonafluorobutan-2-yl)-6-(trifluoromethyl)phenyl]benzamide |
| SMILES | N#Cc1cccc(C(=O)Nc2cccc(C(=O)Nc3c(I)cc(C(F)(C(F)(F)F)C(F)(F)C(F)(F)F)cc3C(F)(F)F)c2F)c1 |
| InChI | InChI=1S/C26H11F13IN3O2/c27-18-14(5-2-6-17(18)42-20(44)12-4-1-3-11(7-12)10-41)21(45)43-19-15(23(29,30)31)8-13(9-16(19)40)22(28,25(34,35)36)24(32,33)26(37,38)39/h1-9H,(H,42,44)(H,43,45) |
| InChIKey | BSQOFYLWPIXOCX-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.27 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|