C23H12Cl2F8N2O2 — CID 153361413
3-benzamido-N-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-fluorobenzamide (PubChem CID 153361413) has the molecular formula C23H12Cl2F8N2O2 and a molecular weight of 571.25 g/mol. Its IUPAC name is 3-benzamido-N-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-fluorobenzamide.
| Compound Name | 3-benzamido-N-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 153361413 |
| Molecular Formula | C23H12Cl2F8N2O2 |
| Molecular Weight | 571.25 g/mol |
| Exact Mass | 570.01 |
| IUPAC Name | 3-benzamido-N-[2,6-dichloro-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]-2-fluorobenzamide |
| SMILES | O=C(Nc1cccc(C(=O)Nc2c(Cl)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2Cl)c1F)c1ccccc1 |
| InChI | InChI=1S/C23H12Cl2F8N2O2/c24-14-9-12(21(27,22(28,29)30)23(31,32)33)10-15(25)18(14)35-20(37)13-7-4-8-16(17(13)26)34-19(36)11-5-2-1-3-6-11/h1-10H,(H,34,36)(H,35,37) |
| InChIKey | TZIGCKPEYQPKEJ-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.25 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |